2-[bis(3-methyl-1H-indol-2-yl)methyl]-3-methyl-1H-indole structure
|
Common Name | 2-[bis(3-methyl-1H-indol-2-yl)methyl]-3-methyl-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 548-12-9 | Molecular Weight | 403.51800 | |
| Density | 1.265g/cm3 | Boiling Point | 675.6ºC at 760 mmHg | |
| Molecular Formula | C28H25N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.8ºC | |
| Name | 2-[bis(3-methyl-1H-indol-2-yl)methyl]-3-methyl-1H-indole |
|---|
| Density | 1.265g/cm3 |
|---|---|
| Boiling Point | 675.6ºC at 760 mmHg |
| Molecular Formula | C28H25N3 |
| Molecular Weight | 403.51800 |
| Flash Point | 297.8ºC |
| Exact Mass | 403.20500 |
| PSA | 47.37000 |
| LogP | 7.23590 |
| Index of Refraction | 1.76 |
| InChIKey | QBMNQDIFIOJXED-UHFFFAOYSA-N |
| SMILES | Cc1c(C(c2[nH]c3ccccc3c2C)c2[nH]c3ccccc3c2C)[nH]c2ccccc12 |
|
~85%
2-[bis(3-methyl... CAS#:548-12-9 |
| Literature: Singh, Nongthombam G.; Kathing, Chingrishon; Rani, Jims W. S.; Nongkhlaw, Rishan L. Journal of the Chinese Chemical Society, 2014 , vol. 61, # 4 p. 442 - 446 |
|
~24%
2-[bis(3-methyl... CAS#:548-12-9
Detail
|
| Literature: Pindur, Ulf; Mueller, Johann Journal of Heterocyclic Chemistry, 1987 , vol. 24, p. 159 - 163 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |