Protohypericin structure
|
Common Name | Protohypericin | ||
|---|---|---|---|---|
| CAS Number | 548-03-8 | Molecular Weight | 476.47600 | |
| Density | 1.736g/cm3 | Boiling Point | 954.3ºC at 760mmHg | |
| Molecular Formula | C30H18O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 544.7ºC | |
Use of ProtohypericinProtohypericin is a naturally occurring naphthodianthrone derived from plant Hypericum perforatum. Radioiodinated protohypericin is used in Tumor necrosis targeted radiotherapy[1][2]. |
| Name | Protohypericin |
|---|---|
| Synonym | More Synonyms |
| Description | Protohypericin is a naturally occurring naphthodianthrone derived from plant Hypericum perforatum. Radioiodinated protohypericin is used in Tumor necrosis targeted radiotherapy[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.736g/cm3 |
|---|---|
| Boiling Point | 954.3ºC at 760mmHg |
| Molecular Formula | C30H18O8 |
| Molecular Weight | 476.47600 |
| Flash Point | 544.7ºC |
| Exact Mass | 476.12600 |
| PSA | 121.38000 |
| LogP | 6.89400 |
| InChIKey | DPKVSJZTYNGFAW-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)c2c(O)c3c(O)cc(O)c4c5c(O)cc(O)c6c(O)c7c(=O)cc(C)cc7c(c65)c(c2c1)c34 |
| HS Code | 2914400090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,3,4,6,8,15-Hexahydroxy-10,13-dimethyl-dibenzo[a,o]perylen-7,16-dion |
| Dibenzo(a,o)perylene-7,16-dione,1,3,4,6,8,15-hexahydroxy-10,11-dimethyl |
| 1,3,4,6,8,15-hexahydroxy-10,13-dimethyl-dibenzo[a,o]perylene-7,16-dione |