Benzeneethanesulfonyl azide structure
|
Common Name | Benzeneethanesulfonyl azide | ||
|---|---|---|---|---|
| CAS Number | 54664-50-5 | Molecular Weight | 211.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-diazo-2-phenylethanesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H9N3O2S |
|---|---|
| Molecular Weight | 211.24100 |
| Exact Mass | 211.04200 |
| PSA | 92.27000 |
| LogP | 2.40276 |
| InChIKey | HVLJLAJJIVEYQD-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NS(=O)(=O)CCc1ccccc1 |
|
~72%
Benzeneethanesu... CAS#:54664-50-5 |
| Literature: Abramovitch, Rudolph A.; Holcomb, William D.; Wake, Shigeo Journal of the American Chemical Society, 1981 , vol. 103, # 6 p. 1525 - 1533 |
| Benzeneethanesulfonyl azide |