dinitrodurene
dinitrodurene structure
|
Common Name | dinitrodurene | ||
|---|---|---|---|---|
| CAS Number | 5465-13-4 | Molecular Weight | 224.21300 | |
| Density | 1.258g/cm3 | Boiling Point | 363.4ºC at 760mmHg | |
| Molecular Formula | C10H12N2O4 | Melting Point | 210 °C | |
| MSDS | N/A | Flash Point | 172.9ºC | |
| Name | 1,2,4,5-tetramethyl-3,6-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 363.4ºC at 760mmHg |
| Melting Point | 210 °C |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.21300 |
| Flash Point | 172.9ºC |
| Exact Mass | 224.08000 |
| PSA | 91.64000 |
| LogP | 3.78300 |
| Index of Refraction | 1.572 |
| InChIKey | AEPQXGFMAZTUEA-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c([N+](=O)[O-])c(C)c(C)c1[N+](=O)[O-] |
| Hazard Codes | Xn:Harmful; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | S37/39-S26 |
| RTECS | TJ3490000 |
| HS Code | 2904209090 |
|
~94%
dinitrodurene CAS#:5465-13-4 |
| Literature: Manglik, Ajay K.; Moodie, Roy B.; Schofield, Kenneth; Dedeoglu, Erol; Dutly, Andreas; Rys, Paul Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1981 , p. 1358 - 1366 |
|
~4%
dinitrodurene CAS#:5465-13-4 |
| Literature: Acta Chemica Scandinavica, , vol. 50, # 11 p. 991 - 1008 |
|
~99%
dinitrodurene CAS#:5465-13-4 |
| Literature: Manglik, Ajay K.; Moodie, Roy B.; Schofield, Kenneth; Dedeoglu, Erol; Dutly, Andreas; Rys, Paul Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1981 , p. 1358 - 1366 |
|
~8%
dinitrodurene CAS#:5465-13-4 |
| Literature: Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), , p. 1358 - 1366 |
|
~%
dinitrodurene CAS#:5465-13-4 |
| Literature: Chemische Berichte, , vol. 45, p. 1475 |
|
~%
dinitrodurene CAS#:5465-13-4 |
| Literature: Chemische Berichte, , vol. 42, p. 4163 |
|
~%
dinitrodurene CAS#:5465-13-4 |
| Literature: Chemische Berichte, , vol. 45, p. 1475 |
| Precursor 5 | |
|---|---|
| DownStream 5 | |
CAS#:3102-87-2
CAS#:13171-61-4
CAS#:2217-46-1
CAS#:88166-73-8
CAS#:40395-73-1| HS Code | 2904209090 |
|---|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,3,5,6-tetramethyl-1,4-dinitrobenzene |
| 3,2,4,5-tetramethylbenzene |
| 1,2,4,5-tetramethyl-3,6-dinitro-benzene |
| 3,6-dinitrodurene |
| Dinitrodurene |
| 1,4-Dinitro-2,3,5,6-tetramethyl-benzen |
| EINECS 226-766-8 |
| MFCD00007164 |