Acetamide,N-(4,5-dichloro-2-nitrophenyl)- structure
|
Common Name | Acetamide,N-(4,5-dichloro-2-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 5462-30-6 | Molecular Weight | 249.05100 | |
| Density | 1.573 g/cm3 | Boiling Point | 418.4ºC at 760 mmHg | |
| Molecular Formula | C8H6Cl2N2O3 | Melting Point | 124-128ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 206.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N1-(4,5-Dichloro-2-Nitrophenyl)Acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.573 g/cm3 |
|---|---|
| Boiling Point | 418.4ºC at 760 mmHg |
| Melting Point | 124-128ºC(lit.) |
| Molecular Formula | C8H6Cl2N2O3 |
| Molecular Weight | 249.05100 |
| Flash Point | 206.8ºC |
| Exact Mass | 247.97600 |
| PSA | 74.92000 |
| LogP | 3.45620 |
| Index of Refraction | 1.637 |
| InChIKey | ZEGRPTYRAGSSBH-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | 26-36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
|
~%
Acetamide,N-(4,... CAS#:5462-30-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 38, # 10 p. 1786 - 1792 |
|
~%
Acetamide,N-(4,... CAS#:5462-30-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 38, # 10 p. 1786 - 1792 |
|
~%
Acetamide,N-(4,... CAS#:5462-30-6 |
| Literature: Journal of Organic Chemistry, , vol. 19, p. 31,34, 35 |
|
~%
Acetamide,N-(4,... CAS#:5462-30-6 |
| Literature: Gazzetta Chimica Italiana, , vol. 107, p. 175 - 180 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(4,5-dichloro-2-nitrophenyl)acetamide |
| MFCD00024301 |