3,7-bis(dimethylamino)-10h-dibenzo[b,e]iodininium formate structure
|
Common Name | 3,7-bis(dimethylamino)-10h-dibenzo[b,e]iodininium formate | ||
|---|---|---|---|---|
| CAS Number | 54593-51-0 | Molecular Weight | 424.27600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21IN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,7-bis(dimethylamino)-10h-dibenzo[b,e]iodininium formate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H21IN2O2 |
|---|---|
| Molecular Weight | 424.27600 |
| Exact Mass | 424.06500 |
| PSA | 46.61000 |
| InChIKey | JKNGRWWFNRSJPV-UHFFFAOYSA-M |
| SMILES | CN(C)c1ccc2c(c1)[I+]c1cc(N(C)C)ccc1C2.O=C[O-] |
| HS Code | 2922499990 |
|---|
|
~%
3,7-bis(dimethy... CAS#:54593-51-0 |
| Literature: Hwang Huaxue Xuebao, 1957 , vol. 23, p. 438,442 Chem.Abstr., 1958 , p. 16356 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Ihc 64 |
| 3,7-Bis-dimethylamino-10H-dibenz[b,e]jodininium,Formiat |
| 3,7-bis-dimethylamino-10H-dibenz[b,e]iodininium,formate |