9-phenyl-3,7-dihydropurine-2,6,8-trione structure
|
Common Name | 9-phenyl-3,7-dihydropurine-2,6,8-trione | ||
|---|---|---|---|---|
| CAS Number | 5443-39-0 | Molecular Weight | 244.20600 | |
| Density | 1.64g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H8N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-phenyl-3,7-dihydropurine-2,6,8-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Molecular Formula | C11H8N4O3 |
| Molecular Weight | 244.20600 |
| Exact Mass | 244.06000 |
| PSA | 103.51000 |
| Index of Refraction | 1.748 |
| InChIKey | UTABRMXJVYTHEA-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(=O)c2[nH]c(=O)n(-c3ccccc3)c2[nH]1 |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9-phenyl-7,9-dihydro-1h-purine-2,6,8(3h)-trione |
| 9-Phenyl-harnsaeure |
| HMS3086B05 |
| 9-phenyl-uric acid |
| 9-phenyl-7,9-dihydro-3H-purine-2,6,8-trione |