1H-Purine-2,6,8(3H)-trione,9-(2-chlorophenyl)-7,9-dihydro-
Modify Date: 2025-09-11 19:38:24
1H-Purine-2,6,8(3H)-trione,9-(2-chlorophenyl)-7,9-dihydro- structure
|
Common Name | 1H-Purine-2,6,8(3H)-trione,9-(2-chlorophenyl)-7,9-dihydro- | ||
|---|---|---|---|---|
| CAS Number | 5444-40-6 | Molecular Weight | 278.65100 | |
| Density | 1.74g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H7ClN4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-(2-chlorophenyl)-3,7-dihydropurine-2,6,8-trione |
|---|
| Density | 1.74g/cm3 |
|---|---|
| Molecular Formula | C11H7ClN4O3 |
| Molecular Weight | 278.65100 |
| Exact Mass | 278.02100 |
| PSA | 103.51000 |
| LogP | 0.34880 |
| Index of Refraction | 1.754 |
| InChIKey | RGIOLRJJEJLBHC-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(=O)c2[nH]c(=O)n(-c3ccccc3Cl)c2[nH]1 |
| HS Code | 2933990090 |
|---|
|
~%
1H-Purine-2,6,8... CAS#:5444-40-6 |
| Literature: Koppel; Robins Journal of the American Chemical Society, 1958 , vol. 80, p. 2751,2753 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |