2,4(1H,3H)-Pyrimidinedione,6-amino-5-nitroso- structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,6-amino-5-nitroso- | ||
|---|---|---|---|---|
| CAS Number | 5442-24-0 | Molecular Weight | 156.10000 | |
| Density | 0.806 g/mL at 25 °C(lit.) | Boiling Point | 119.2 °C750 mm Hg(lit.) | |
| Molecular Formula | C4H4N4O3 | Melting Point | -73°C | |
| MSDS | N/A | Flash Point | 57 °F | |
| Name | 4-Amino-2,6-dihydroxy-5-nitrosopyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.806 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 119.2 °C750 mm Hg(lit.) |
| Melting Point | -73°C |
| Molecular Formula | C4H4N4O3 |
| Molecular Weight | 156.10000 |
| Flash Point | 57 °F |
| Exact Mass | 156.02800 |
| PSA | 121.69000 |
| LogP | 0.44910 |
| Index of Refraction | n20/D 1.386(lit.) |
| InChIKey | DKPCSXFEWFSECE-UHFFFAOYSA-N |
| SMILES | Nc1[nH]c(=O)[nH]c(=O)c1N=O |
| Precursor 6 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Amino-5-nitrosouracil |
| MFCD00012340 |
| EINECS 226-633-4 |