4,4,5,5-tetrachloro-2-methyl-1,2-thiazolidin-3-one
Modify Date: 2025-08-26 14:19:41
4,4,5,5-tetrachloro-2-methyl-1,2-thiazolidin-3-one structure
|
Common Name | 4,4,5,5-tetrachloro-2-methyl-1,2-thiazolidin-3-one | ||
|---|---|---|---|---|
| CAS Number | 54414-97-0 | Molecular Weight | 254.95000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H3Cl4NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,4,5,5-tetrachloro-2-methyl-1,2-thiazolidin-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4H3Cl4NOS |
|---|---|
| Molecular Weight | 254.95000 |
| Exact Mass | 252.86900 |
| PSA | 45.61000 |
| LogP | 2.34980 |
| InChIKey | PDGOVYBTZIEWRC-UHFFFAOYSA-N |
| SMILES | CN1SC(Cl)(Cl)C(Cl)(Cl)C1=O |
|
~%
4,4,5,5-tetrach... CAS#:54414-97-0 |
| Literature: Weiler,E.D. et al. Journal of Heterocyclic Chemistry, 1976 , vol. 13, p. 1321 - 1323 |
|
~%
4,4,5,5-tetrach... CAS#:54414-97-0 |
| Literature: Rohm and Haas Company Patent: US4169949 A1, 1979 ; |
|
~%
4,4,5,5-tetrach... CAS#:54414-97-0 |
| Literature: Weiler,E.D. et al. Journal of Heterocyclic Chemistry, 1976 , vol. 13, p. 1321 - 1323 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-methyl-4,4,5,5-tetrachloroisothiazolidin-3-one |
| 4,4,5,5-tetrachloro-2-methyl-3-isothiazolidinone |
| 2-Methyl-4.4.5.5-tetrachlorisothiazolidin-3-on |
| 2-methyl-4,4,5,5-tetrachloro-3-isothiazolidinone |
| 3-Isothiazolidinone,4,4,5,5-tetrachloro-2-methyl |
| 4,4,5,5-tetrachloro-2-methyl-isothiazolidin-3-one |