4,5,5-trichloro-2,4-dimethyl-1,2-thiazolidin-3-one
Modify Date: 2025-09-20 20:20:16
4,5,5-trichloro-2,4-dimethyl-1,2-thiazolidin-3-one structure
|
Common Name | 4,5,5-trichloro-2,4-dimethyl-1,2-thiazolidin-3-one | ||
|---|---|---|---|---|
| CAS Number | 54414-90-3 | Molecular Weight | 234.53100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H6Cl3NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,5,5-trichloro-2,4-dimethyl-1,2-thiazolidin-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5H6Cl3NOS |
|---|---|
| Molecular Weight | 234.53100 |
| Exact Mass | 232.92400 |
| PSA | 45.61000 |
| LogP | 2.17340 |
| InChIKey | XHYUFVOJRNXUEL-UHFFFAOYSA-N |
| SMILES | CN1SC(Cl)(Cl)C(C)(Cl)C1=O |
|
~%
4,5,5-trichloro... CAS#:54414-90-3 |
| Literature: Weiler,E.D. et al. Journal of Heterocyclic Chemistry, 1976 , vol. 13, p. 1321 - 1323 |
|
~%
4,5,5-trichloro... CAS#:54414-90-3 |
| Literature: Weiler,E.D. et al. Journal of Heterocyclic Chemistry, 1976 , vol. 13, p. 1321 - 1323 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,4-dimethyl-4,5,5-trichloroisothiazolidin-3-one |
| 4,5,5-trichloro-2,4-dimethyl-isothiazolidin-3-one |
| 2.4-Dimethyl-4.5.5-trichlorisothiazolidin-3-on |
| 4,5,5-trichloro-2,4-dimethyl-3-isothiazolidinone |
| 3-Isothiazolidinone,4,5,5-trichloro-2,4-dimethyl |