4,4'-Dichloro-2,2'-biphenyldicarboxylic acid
Modify Date: 2025-08-22 12:37:04
4,4'-Dichloro-2,2'-biphenyldicarboxylic acid structure
|
Common Name | 4,4'-Dichloro-2,2'-biphenyldicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 54389-65-0 | Molecular Weight | 311.117 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 458.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H8Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.1±27.3 °C | |
| Name | 4,4'-Dichlorodiphenic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 458.6±40.0 °C at 760 mmHg |
| Molecular Formula | C14H8Cl2O4 |
| Molecular Weight | 311.117 |
| Flash Point | 231.1±27.3 °C |
| Exact Mass | 309.979950 |
| PSA | 74.60000 |
| LogP | 3.98 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | QODNHPKXKPBBTG-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Cl)ccc1-c1ccc(Cl)cc1C(=O)O |
| HS Code | 2917399090 |
|---|
|
~81%
4,4'-Dichloro-2... CAS#:54389-65-0 |
| Literature: Vonlanthen, David; Mishchenko, Artem; Elbing, Mark; Neuburger, Markus; Wandlowski, Thomas; Mayor, Marcel Angewandte Chemie - International Edition, 2009 , vol. 48, # 47 p. 8886 - 8890 |
|
~%
4,4'-Dichloro-2... CAS#:54389-65-0
Detail
|
| Literature: Journal of the American Chemical Society, , vol. 55, p. 4262,4270 |
CAS#:6297-11-6![3,9-dichlorobenzo[d][2]benzoxepine-5,7-dione structure](https://image.chemsrc.com/caspic/344/52767-29-0.png)
CAS#:52767-29-0| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4,4'-Dichlorodiphenicacid |
| [1,1'-Biphenyl]-2,2'-dicarboxylic acid, 4,4'-dichloro- |
| 4,4'-Dichlordiphensaeure |
| 4,4'-Dichloro-2,2'-diphenic-acid |
| 4,4'-dichlorobiphenyl-2,2'-dicarboxylic acid |
| 4,4'-Dichloro-2,2'-biphenyldicarboxylic acid |