diethyl 2-(4-methyl-3-oxo-1-phenyl-pentyl)propanedioate structure
|
Common Name | diethyl 2-(4-methyl-3-oxo-1-phenyl-pentyl)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 5435-09-6 | Molecular Weight | 334.40700 | |
| Density | 1.08g/cm3 | Boiling Point | 433.3ºC at 760 mmHg | |
| Molecular Formula | C19H26O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.1ºC | |
| Name | diethyl 2-(4-methyl-3-oxo-1-phenylpentyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 433.3ºC at 760 mmHg |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.40700 |
| Flash Point | 187.1ºC |
| Exact Mass | 334.17800 |
| PSA | 69.67000 |
| LogP | 3.12780 |
| Index of Refraction | 1.495 |
| InChIKey | OSJMHLPXXZNODR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)C(CC(=O)C(C)C)c1ccccc1 |
| HS Code | 2918300090 |
|---|
|
~80%
diethyl 2-(4-me... CAS#:5435-09-6 |
| Literature: Garcia-Raso, A.; Garcia-Raso, J; Campaner, B.; Mestres, R.; Sinisterra, J. V. Synthesis, 1982 , # 12 p. 1037 - 1041 |
|
~%
diethyl 2-(4-me... CAS#:5435-09-6 |
| Literature: Cox; McElvain Journal of the American Chemical Society, 1934 , vol. 56, p. 2459,2461 |
|
~%
diethyl 2-(4-me... CAS#:5435-09-6 |
| Literature: Robl, Jeffrey A. Tetrahedron Letters, 1990 , vol. 31, # 24 p. 3421 - 3424 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (4-Methyl-3-oxo-1-phenyl-pentyl)-malonsaeure-diaethylester |
| diethyl(4-methyl-3-oxo-1-phenylpentyl)propanedioate |
| (4-methyl-3-oxo-1-phenyl-pentyl)-malonic acid diethyl ester |