methanetrisulphonic acid structure
|
Common Name | methanetrisulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 54322-33-7 | Molecular Weight | 256.23200 | |
| Density | 2.536g/cm3 | Boiling Point | N/A | |
| Molecular Formula | CH4O9S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methanetrisulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.536g/cm3 |
|---|---|
| Molecular Formula | CH4O9S3 |
| Molecular Weight | 256.23200 |
| Exact Mass | 255.90200 |
| PSA | 188.25000 |
| LogP | 1.17580 |
| Index of Refraction | 1.669 |
| InChIKey | NARPMWPOFWHFDX-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)C(S(=O)(=O)O)S(=O)(=O)O |
| HS Code | 2904100000 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| methane trisulphonate |
| methane trisulfonic acid |
| EINECS 259-097-5 |
| Methanetrisulphonic acid |
| Methantrisulfonsaeure |