2-amino-(4'-nitro)acetophenone hydrochloride structure
|
Common Name | 2-amino-(4'-nitro)acetophenone hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 5425-81-0 | Molecular Weight | 216.622 | |
| Density | 1.32g/cm3 | Boiling Point | 339.1ºC at 760 mmHg | |
| Molecular Formula | C8H9ClN2O3 | Melting Point | 134ºC | |
| MSDS | N/A | Flash Point | 158.9ºC | |
| Name | 2-amino-1-(4-nitrophenyl)ethanone,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 339.1ºC at 760 mmHg |
| Melting Point | 134ºC |
| Molecular Formula | C8H9ClN2O3 |
| Molecular Weight | 216.622 |
| Flash Point | 158.9ºC |
| Exact Mass | 216.030167 |
| PSA | 88.91000 |
| LogP | 2.76170 |
| Index of Refraction | 1.594 |
| InChIKey | UJBOVJRECBNSDI-UHFFFAOYSA-N |
| SMILES | Cl.NCC(=O)c1ccc([N+](=O)[O-])cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922399090 |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-amino-1-(4-nitrophenyl)ethan-1-one hydrochloride |
| 2-Amino-4'-nitroacetophenone HCl |
| MFCD00025591 |
| Ethanone, 2-amino-1-(4-nitrophenyl)-, hydrochloride (1:1) |
| 2-Amino-p-nitro-acetophenone HCl |
| 2-Amino-1-(4-nitrophenyl)ethanone hydrochloride (1:1) |
| 2-Amino-p-nitro-acetophenone hydrochloride |