p-Toluenearsonic acid, a-acetamido-(8CI)
Modify Date: 2025-10-01 19:17:59
p-Toluenearsonic acid, a-acetamido-(8CI) structure
|
Common Name | p-Toluenearsonic acid, a-acetamido-(8CI) | ||
|---|---|---|---|---|
| CAS Number | 5425-64-9 | Molecular Weight | 273.11700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12AsNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-(acetamidomethyl)phenyl]arsonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H12AsNO4 |
|---|---|
| Molecular Weight | 273.11700 |
| Exact Mass | 272.99800 |
| PSA | 86.63000 |
| InChIKey | GZCPLGRTVSYELI-UHFFFAOYSA-N |
| SMILES | CC(=O)NCc1ccc([As](=O)(O)O)cc1 |
| HS Code | 2931900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:5410-39-9
CAS#:5425-18-3| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| {4-[(acetylamino)methyl]phenyl}arsonic acid |
| 4-Acetaminomethyl-phenylarsonsaeure |
| [4-(Acetylamino-methyl)-phenyl]-arsonsaeure |