ethyl 2-acetamido-2-cyano-pent-4-enoate
Modify Date: 2024-01-09 20:34:08
ethyl 2-acetamido-2-cyano-pent-4-enoate structure
|
Common Name | ethyl 2-acetamido-2-cyano-pent-4-enoate | ||
|---|---|---|---|---|
| CAS Number | 5424-14-6 | Molecular Weight | 210.23000 | |
| Density | 1.097g/cm3 | Boiling Point | 368.4ºC at 760 mmHg | |
| Molecular Formula | C10H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.6ºC | |
| Name | ethyl 2-acetamido-2-cyanopent-4-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.097g/cm3 |
|---|---|
| Boiling Point | 368.4ºC at 760 mmHg |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23000 |
| Flash Point | 176.6ºC |
| Exact Mass | 210.10000 |
| PSA | 79.19000 |
| LogP | 0.91498 |
| Index of Refraction | 1.469 |
| InChIKey | XDTDKHLOTPVRKN-UHFFFAOYSA-N |
| SMILES | C=CCC(C#N)(NC(C)=O)C(=O)OCC |
| HS Code | 2926909090 |
|---|
|
~39%
ethyl 2-acetami... CAS#:5424-14-6 |
| Literature: Tendler, Saul J. B.; Threadgill, Michael D.; Tisdale, Michael J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 2617 - 2624 |
|
~%
ethyl 2-acetami... CAS#:5424-14-6 |
| Literature: Matsumoto Chemical and pharmaceutical bulletin, 1967 , vol. 15, # 12 p. 1990 - 1995 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:1069-48-3| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Acetylamino-2-cyan-pent-4-ensaeure-aethylester |
| Acetamino-allyl-cyan-essigsaeure-aethylester |
| 1-Acetamino-buten-(3)-dicarbonsaeure-(1.1)-aethylester-nitril |
| 2-acetylamino-2-cyano-pent-4-enoic acid ethyl ester |
| Acetamino-allyl-malonsaeure-aethylester-nitril |
| Ethyl 2-Acetamido-2-cyano-4-pentenoate |
| ethyl 2-(acetylamino)-2-cyanopent-4-enoate |