(E)-3-(2-chlorophenyl)-1-(4-methoxyphenyl)prop-2-en-1-one structure
|
Common Name | (E)-3-(2-chlorophenyl)-1-(4-methoxyphenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 5424-03-3 | Molecular Weight | 272.72600 | |
| Density | 1.207g/cm3 | Boiling Point | 427.4ºC at 760 mmHg | |
| Molecular Formula | C16H13ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.3ºC | |
| Name | (E)-3-(2-chlorophenyl)-1-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 427.4ºC at 760 mmHg |
| Molecular Formula | C16H13ClO2 |
| Molecular Weight | 272.72600 |
| Flash Point | 172.3ºC |
| Exact Mass | 272.06000 |
| PSA | 26.30000 |
| LogP | 4.24470 |
| Index of Refraction | 1.613 |
| InChIKey | DGBWMHMJGJSEOH-DHZHZOJOSA-N |
| SMILES | COc1ccc(C(=O)C=Cc2ccccc2Cl)cc1 |
| HS Code | 2914700090 |
|---|
|
~79%
(E)-3-(2-chloro... CAS#:5424-03-3 |
| Literature: Gezegen, Hayreddin; Karaman, Isa; Ceylan, Mustafa; Dilmac, Merve Acta Poloniae Pharmaceutica - Drug Research, 2012 , vol. 69, # 5 p. 893 - 900 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3-(2-chlorophenyl)-1-(4-methoxyphenyl)propenone |
| 2-chloro-4'-methoxy-chalcone |
| 2-Chlor-4'-methoxy-chalkon |
| 2-chlorobenzal-4'-methoxyacetophenone |