Diethyl 2,5-dibromohexanedioate structure
|
Common Name | Diethyl 2,5-dibromohexanedioate | ||
|---|---|---|---|---|
| CAS Number | 54221-37-3 | Molecular Weight | 360.040 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 338.6±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H16Br2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.6±27.9 °C | |
| Name | (2R,5S)-rel-Diethyl 2,5-dibromohexanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 338.6±42.0 °C at 760 mmHg |
| Molecular Formula | C10H16Br2O4 |
| Molecular Weight | 360.040 |
| Flash Point | 158.6±27.9 °C |
| Exact Mass | 357.941528 |
| PSA | 52.60000 |
| LogP | 3.61 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.503 |
| InChIKey | UBCNJHBDCUBIPB-OCAPTIKFSA-N |
| SMILES | CCOC(=O)C(Br)CCC(Br)C(=O)OCC |
| Hazard Codes | C |
|---|---|
| HS Code | 2917190090 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Hexanedioic acid, 2,5-dibromo-, diethyl ester, (2R,5S)- |
| Diethyl (2R,5S)-2,5-dibromohexanedioate |
| diethyl 2,5-dibromohexanedioate |