3-(3,4,5-trimethoxyphenyl)benzo[f]chromen-1-one
Modify Date: 2025-09-23 21:53:51
![3-(3,4,5-trimethoxyphenyl)benzo[f]chromen-1-one Structure](https://image.chemsrc.com/caspic/391/54198-02-6.png)
3-(3,4,5-trimethoxyphenyl)benzo[f]chromen-1-one structure
|
Common Name | 3-(3,4,5-trimethoxyphenyl)benzo[f]chromen-1-one | ||
|---|---|---|---|---|
| CAS Number | 54198-02-6 | Molecular Weight | 362.37500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(3,4,5-trimethoxyphenyl)benzo[f]chromen-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H18O5 |
|---|---|
| Molecular Weight | 362.37500 |
| Exact Mass | 362.11500 |
| PSA | 57.90000 |
| LogP | 4.63900 |
| InChIKey | HXRGYQMZSNYIEW-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2cc(=O)c3c(ccc4ccccc43)o2)cc(OC)c1OC |
|
~%
3-(3,4,5-trimet... CAS#:54198-02-6 |
| Literature: Menon; Venkataraman Journal of the Chemical Society, 1931 , p. 2591,2596 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-(3,4,5-trimethoxyphenyl)-6-oxatricyclo[8.4.0.0^{2,7}]tetradeca-1(10),2(7),4,8,11,13-hexaen-3-one |
| 3-(3,4,5-Trimethoxy-phenyl)-benzo[f]chromen-1-on |
| 1H-Naphtho[2,1-b]pyran-1-one,3-(3,4,5-trimethoxyphenyl) |
| 3-(3,4,5-trimethoxy-phenyl)-benzo[f]chromen-1-one |