3-(trimethylsiloxypropyl)dimethylchlorosilane structure
|
Common Name | 3-(trimethylsiloxypropyl)dimethylchlorosilane | ||
|---|---|---|---|---|
| CAS Number | 54175-55-2 | Molecular Weight | 224.876 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 209.7±13.0 °C at 760 mmHg | |
| Molecular Formula | C8H21ClOSi2 | Melting Point | <0ºC | |
| MSDS | N/A | Flash Point | 68.4±12.0 °C | |
| Name | 3-(trimethylsiloxypropyl)dimethylchlorosilane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 209.7±13.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C8H21ClOSi2 |
| Molecular Weight | 224.876 |
| Flash Point | 68.4±12.0 °C |
| Exact Mass | 224.081940 |
| PSA | 9.23000 |
| LogP | 4.10 |
| Vapour Pressure | 0.3±0.4 mmHg at 25°C |
| Index of Refraction | 1.419 |
| InChIKey | WTIDHBNTNHHZKI-UHFFFAOYSA-N |
| SMILES | C[Si](C)(Cl)CCCO[Si](C)(C)C |
| Risk Phrases | 34 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 2987 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Silane, chlorodimethyl[3-[(trimethylsilyl)oxy]propyl]- |
| 3-(trimethylsiloxy)propyldimethylchlorosilane |
| 1-trimethylsiloxy-3-chlorodimethylsilylpropane |
| Trimethylsiloxypropyldimethylchlorosilane |
| Chloro(dimethyl){3-[(trimethylsilyl)oxy]propyl}silane |