4-dichloroarsanyl-N,N-diethyl-benzamide structure
|
Common Name | 4-dichloroarsanyl-N,N-diethyl-benzamide | ||
|---|---|---|---|---|
| CAS Number | 5410-57-1 | Molecular Weight | 322.06300 | |
| Density | N/A | Boiling Point | 416.4ºC at 760 mmHg | |
| Molecular Formula | C11H14AsCl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.6ºC | |
| Name | 4-dichloroarsino-benzoic acid diethylamide |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 416.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C11H14AsCl2NO |
| Molecular Weight | 322.06300 |
| Flash Point | 205.6ºC |
| Exact Mass | 320.96700 |
| PSA | 20.31000 |
| LogP | 2.34140 |
| InChIKey | SLKDKNAQRMPEIJ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)c1ccc([As](Cl)Cl)cc1 |
|
~%
4-dichloroarsan... CAS#:5410-57-1 |
| Literature: Gough; King Journal of the Chemical Society, 1930 , p. 669,683 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Dichlorarsino-N.N-diaethyl-benzamid |
| 4-dibutylsulfamoyl-benzoic acid |
| Antidipsin |
| Longacid |
| 4-Dibutylsulfamoyl-benzoesaeure |
| 4-Carboxy-N,N-dibutylbenzenesulfonamide |
| Butacid |
| 4-<N,N-Dibutyl-sulfamoyl>-benzoesaeure |
| 4-Dichlorarsino-benzoesaeure-diaethylamid |
| p-Carboxybenzenesulfodibutylamide |