4-Chloro-2-(trifluoromethyl)benzenesulfonyl chloride
Modify Date: 2025-08-25 19:22:22
4-Chloro-2-(trifluoromethyl)benzenesulfonyl chloride structure
|
Common Name | 4-Chloro-2-(trifluoromethyl)benzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 54090-42-5 | Molecular Weight | 279.06400 | |
| Density | 1.626g/cm3 | Boiling Point | 273.9ºC at 760 mmHg | |
| Molecular Formula | C7H3Cl2F3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 119.5ºC | |
| Name | 4-Chloro-2-(trifluoromethyl)benzene-1-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.626g/cm3 |
|---|---|
| Boiling Point | 273.9ºC at 760 mmHg |
| Molecular Formula | C7H3Cl2F3O2S |
| Molecular Weight | 279.06400 |
| Flash Point | 119.5ºC |
| Exact Mass | 277.91800 |
| PSA | 42.52000 |
| LogP | 4.36710 |
| Index of Refraction | 1.497 |
| InChIKey | DQKPVVIVMURTDM-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc(Cl)cc1C(F)(F)F |
| Storage condition | 2~8℃ |
| Hazard Codes | C |
|---|---|
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-chloro-2-(trifluoromethyl)benzenesulfonyl chloride |