1,3-Dioxane,2,5,5-trimethyl-2-phenyl- structure
|
Common Name | 1,3-Dioxane,2,5,5-trimethyl-2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 5406-58-6 | Molecular Weight | 206.28100 | |
| Density | 0.984g/cm3 | Boiling Point | 274.8ºC at 760mmHg | |
| Molecular Formula | C13H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.4ºC | |
| Name | 2,5,5-trimethyl-2-phenyl-1,3-dioxane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.984g/cm3 |
|---|---|
| Boiling Point | 274.8ºC at 760mmHg |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28100 |
| Flash Point | 125.4ºC |
| Exact Mass | 206.13100 |
| PSA | 18.46000 |
| LogP | 2.93230 |
| Index of Refraction | 1.484 |
| InChIKey | AALXTPRRKXUUOM-UHFFFAOYSA-N |
| SMILES | CC1(C)COC(C)(c2ccccc2)OC1 |
| HS Code | 2934999090 |
|---|
|
~97%
1,3-Dioxane,2,5... CAS#:5406-58-6 |
| Literature: Sarkar, Anjana; Yemul, Omprakash S.; Bandgar; Gaikwad; Wadgaonkar, Prakash P. Organic Preparations and Procedures International, 1996 , vol. 28, # 5 p. 613 - 617 |
|
~88%
1,3-Dioxane,2,5... CAS#:5406-58-6 |
| Literature: Rahimizadeh, Mohammad; Bakavoli, Mehdi; Shiri, Ali; Eshghi, Hossein; Saberi, Sattar Journal of Chemical Research, 2008 , # 12 p. 704 - 706 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-phenyl-2,5,5-trimethyl-1,3-dioxane |
| m-Dioxane,2,5,5-trimethyl-2-phenyl |
| 1,3-Dioxane,2,5,5-trimethyl-2-phenyl |
| 2,5,5-trimethyl-2-phenyl-[1,3]dioxane |