2,5,5-Trimethyl-2-(4-methyl-3-pentenyl)-1,3-dioxane structure
|
Common Name | 2,5,5-Trimethyl-2-(4-methyl-3-pentenyl)-1,3-dioxane | ||
|---|---|---|---|---|
| CAS Number | 85030-15-5 | Molecular Weight | 212.32800 | |
| Density | 0.875g/cm3 | Boiling Point | 255.1ºC at 760 mmHg | |
| Molecular Formula | C13H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 111ºC | |
| Name | 2,5,5-trimethyl-2-(4-methylpent-3-enyl)-1,3-dioxane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.875g/cm3 |
|---|---|
| Boiling Point | 255.1ºC at 760 mmHg |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.32800 |
| Flash Point | 111ºC |
| Exact Mass | 212.17800 |
| PSA | 18.46000 |
| LogP | 3.52200 |
| Index of Refraction | 1.435 |
| InChIKey | SXMVQVKIMXRILP-UHFFFAOYSA-N |
| SMILES | CC(C)=CCCC1(C)OCC(C)(C)CO1 |
| HS Code | 2934999090 |
|---|
|
~%
2,5,5-Trimethyl... CAS#:85030-15-5 |
| Literature: Lee, Albert W. M. Journal of the Chemical Society, Chemical Communications, 1984 , # 9 p. 578 - 579 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 285-140-2 |
| 2,5,5-trimethyl-2-(4-methylpent-3-en-1-yl)-1,3-dioxane |
| 2,5,5-Trimethyl-2-(4-methyl-3-pentenyl)-1,3-dioxane |