3-(Perfluoro-3-methylbutyl)-1,2-propenoxide structure
|
Common Name | 3-(Perfluoro-3-methylbutyl)-1,2-propenoxide | ||
|---|---|---|---|---|
| CAS Number | 54009-81-3 | Molecular Weight | 326.10700 | |
| Density | 1.567g/cm3 | Boiling Point | 123.7ºC at 760mmHg | |
| Molecular Formula | C8H5F11O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 34.3ºC | |
| Name | 3-(Perfluoro-3-methylbutyl)-1,2-propenoxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.567g/cm3 |
|---|---|
| Boiling Point | 123.7ºC at 760mmHg |
| Molecular Formula | C8H5F11O |
| Molecular Weight | 326.10700 |
| Flash Point | 34.3ºC |
| Exact Mass | 326.01600 |
| PSA | 12.53000 |
| LogP | 3.87880 |
| Index of Refraction | n20/D 1.324(lit.) |
| InChIKey | BKXKCZGEIQKTBI-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)CC1CO1 |
| HS Code | 2910900090 |
|---|---|
| Summary | 2910900090. epoxides, epoxyalcohols, epoxyphenols and epoxyethers, with a three-membered ring, and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2-[2,2,3,3,4,5,5,5-octafluoro-4-(trifluoromethyl)pentyl]oxirane |
| MFCD00236087 |