2-[2,3-dichloro-4-(2-methylbutanoyl)phenoxy]acetic acid structure
|
Common Name | 2-[2,3-dichloro-4-(2-methylbutanoyl)phenoxy]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 5378-94-9 | Molecular Weight | 305.15400 | |
| Density | 1.327g/cm3 | Boiling Point | 445.5ºC at 760 mmHg | |
| Molecular Formula | C13H14Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.3ºC | |
| Name | 2-[2,3-dichloro-4-(2-methylbutanoyl)phenoxy]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.327g/cm3 |
|---|---|
| Boiling Point | 445.5ºC at 760 mmHg |
| Molecular Formula | C13H14Cl2O4 |
| Molecular Weight | 305.15400 |
| Flash Point | 223.3ºC |
| Exact Mass | 304.02700 |
| PSA | 63.60000 |
| LogP | 3.68560 |
| Index of Refraction | 1.546 |
| InChIKey | MBIDVLCHMJNEAM-UHFFFAOYSA-N |
| SMILES | CCC(C)C(=O)c1ccc(OCC(=O)O)c(Cl)c1Cl |
| HS Code | 2918990090 |
|---|
|
~99%
2-[2,3-dichloro... CAS#:5378-94-9 |
| Literature: Ikawa, Takashi; Sajiki, Hironao; Hirota, Kosaku Tetrahedron, 2005 , vol. 61, # 8 p. 2217 - 2231 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Dihydroethacrynate |
| (2,3-dichloro-4-sec-pentanoyl)phenoxyacetic acid |
| dihydroethacrynic acid |
| [2,3-dichloro-4-(2-methylbutanoyl)phenoxy]acetic acid |