N-(2-cyano-3-ethoxyprop-2-enoyl)benzamide
Modify Date: 2025-08-26 20:07:38
N-(2-cyano-3-ethoxyprop-2-enoyl)benzamide structure
|
Common Name | N-(2-cyano-3-ethoxyprop-2-enoyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 53762-12-2 | Molecular Weight | 244.24600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-cyano-3-ethoxyprop-2-enoyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H12N2O3 |
|---|---|
| Molecular Weight | 244.24600 |
| Exact Mass | 244.08500 |
| PSA | 82.68000 |
| LogP | 1.96178 |
| InChIKey | PTUDQCRZXMSKSL-UHFFFAOYSA-N |
| SMILES | CCOC=C(C#N)C(=O)NC(=O)c1ccccc1 |
| HS Code | 2926909090 |
|---|
|
~%
N-(2-cyano-3-et... CAS#:53762-12-2 |
| Literature: Shaw Journal of the Chemical Society, 1955 , p. 1834,1838 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (3-Aethoxy-2-cyan-acryloyl)-benzoyl-amin |
| (3-ethoxy-2-cyano-acryloyl)-benzoyl-amine |
| N-Benzoyl-2-cyan-3-ethoxyacrylamid |
| Benzamide,N-(2-cyano-3-ethoxy-1-oxo-2-propenyl) |