L-Methionine,N,N'-carbonylbis-, bis(4-nitrophenyl) ester (9CI)
Modify Date: 2025-09-09 11:45:13
L-Methionine,N,N'-carbonylbis-, bis(4-nitrophenyl) ester (9CI) structure
|
Common Name | L-Methionine,N,N'-carbonylbis-, bis(4-nitrophenyl) ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 53751-62-5 | Molecular Weight | 566.60400 | |
| Density | 1.387g/cm3 | Boiling Point | 804.2ºC at 760mmHg | |
| Molecular Formula | C23H26N4O9S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 440.2ºC | |
| Name | (4-nitrophenyl) 4-methylsulfanyl-2-[[4-methylsulfanyl-1-(4-nitrophenoxy)-1-oxobutan-2-yl]carbamoylamino]butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.387g/cm3 |
|---|---|
| Boiling Point | 804.2ºC at 760mmHg |
| Molecular Formula | C23H26N4O9S2 |
| Molecular Weight | 566.60400 |
| Flash Point | 440.2ºC |
| Exact Mass | 566.11400 |
| PSA | 235.97000 |
| LogP | 5.38480 |
| Index of Refraction | 1.611 |
| InChIKey | UAMQNDYCCRCTJH-UHFFFAOYSA-N |
| SMILES | CSCCC(NC(=O)NC(CCSC)C(=O)Oc1ccc([N+](=O)[O-])cc1)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
|
~%
L-Methionine,N,... CAS#:53751-62-5 |
| Literature: Busse,W.-D.; Carpenter,F.H. Journal of the American Chemical Society, 1974 , vol. 96, p. 5947 - 5949 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| carbonyl bis(l-methionine p-nitrophenyl ester)) |