4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-methyl-9-oxa-2,4,7-triazabicyclo[4.3.0]nona-2,7,10-trien-5-one structure
|
Common Name | 4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-methyl-9-oxa-2,4,7-triazabicyclo[4.3.0]nona-2,7,10-trien-5-one | ||
|---|---|---|---|---|
| CAS Number | 53641-78-4 | Molecular Weight | 283.23700 | |
| Density | 1.94g/cm3 | Boiling Point | 593.7ºC at 760 mmHg | |
| Molecular Formula | C11H13N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312.9ºC | |
| Name | 6-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-one |
|---|
| Density | 1.94g/cm3 |
|---|---|
| Boiling Point | 593.7ºC at 760 mmHg |
| Molecular Formula | C11H13N3O6 |
| Molecular Weight | 283.23700 |
| Flash Point | 312.9ºC |
| Exact Mass | 283.08000 |
| PSA | 130.84000 |
| Index of Refraction | 1.789 |
| InChIKey | RGIJKSOLVKDSNP-UHFFFAOYSA-N |
| SMILES | Cc1nc2c(=O)n(C3OC(CO)C(O)C3O)cnc2o1 |
|
~%
4-[3,4-dihydrox... CAS#:53641-78-4 |
| Literature: Patil; Wise; Townsend; Bloch Journal of Medicinal Chemistry, 1974 , vol. 17, # 12 p. 1282 - 1285 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |