1-(3-trifluoromethyl-phenyl)-pyrrole-2,5-dione structure
|
Common Name | 1-(3-trifluoromethyl-phenyl)-pyrrole-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 53629-19-9 | Molecular Weight | 241.16600 | |
| Density | 1.472g/cm3 | Boiling Point | 315.1ºC at 760 mmHg | |
| Molecular Formula | C11H6F3NO2 | Melting Point | 62-65ºC | |
| MSDS | N/A | Flash Point | 144.4ºC | |
| Name | 1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.472g/cm3 |
|---|---|
| Boiling Point | 315.1ºC at 760 mmHg |
| Melting Point | 62-65ºC |
| Molecular Formula | C11H6F3NO2 |
| Molecular Weight | 241.16600 |
| Flash Point | 144.4ºC |
| Exact Mass | 241.03500 |
| PSA | 37.38000 |
| LogP | 2.19980 |
| Index of Refraction | 1.539 |
| InChIKey | DQGGHYHHYCKIMR-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)N1c1cccc(C(F)(F)F)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2925190090 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00439448 |