MONO-(1S)-(+)-MENTHYL PHTHALATE structure
|
Common Name | MONO-(1S)-(+)-MENTHYL PHTHALATE | ||
|---|---|---|---|---|
| CAS Number | 53623-42-0 | Molecular Weight | 304.38100 | |
| Density | 1.13g/cm3 | Boiling Point | 436.8ºC at 760mmHg | |
| Molecular Formula | C18H24O4 | Melting Point | 108-113ºC(lit.) | |
| MSDS | N/A | Flash Point | 152.2ºC | |
| Name | mono-(1s)-(+)-menthyl phthalate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 436.8ºC at 760mmHg |
| Melting Point | 108-113ºC(lit.) |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.38100 |
| Flash Point | 152.2ºC |
| Exact Mass | 304.16700 |
| PSA | 63.60000 |
| LogP | 4.00240 |
| Index of Refraction | 1.538 |
| InChIKey | LJFJPDHXAWVDSA-ZENOOKHLSA-N |
| SMILES | CC1CCC(C(C)C)C(OC(=O)c2ccccc2C(=O)O)C1 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00045486 |
| Mono-(1S)-(+)-menthyl phthalate |
| mono-menthyl phthalate |