2-(4-methylphenyl)sulfanyl-5-nitro-8-oxa-7,9-diazabicyclo[4.3.0]nona-2,4,6,9-tetraene structure
|
Common Name | 2-(4-methylphenyl)sulfanyl-5-nitro-8-oxa-7,9-diazabicyclo[4.3.0]nona-2,4,6,9-tetraene | ||
|---|---|---|---|---|
| CAS Number | 53619-61-7 | Molecular Weight | 287.29400 | |
| Density | 1.48g/cm3 | Boiling Point | 488.1ºC at 760 mmHg | |
| Molecular Formula | C13H9N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249ºC | |
| Name | 4-(4-methylphenyl)sulfanyl-7-nitro-2,1,3-benzoxadiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 488.1ºC at 760 mmHg |
| Molecular Formula | C13H9N3O3S |
| Molecular Weight | 287.29400 |
| Flash Point | 249ºC |
| Exact Mass | 287.03600 |
| PSA | 110.04000 |
| LogP | 4.11380 |
| Index of Refraction | 1.71 |
| InChIKey | SQAVTBVSLRAJAT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Sc2ccc([N+](=O)[O-])c3nonc23)cc1 |
|
~%
2-(4-methylphen... CAS#:53619-61-7 |
| Literature: Rosso, Mauro Domenico del; Nunno, Leonardo Di; Florio, Saverio; Amorese, Antonio Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1980 , p. 239 - 242 |
|
~%
2-(4-methylphen... CAS#:53619-61-7 |
| Literature: Rosso, Mauro Domenico del; Nunno, Leonardo Di; Florio, Saverio; Amorese, Antonio Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1980 , p. 239 - 242 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| hms555a18 |