N,N-diethyl-5-(2,3,5-trimethylphenoxy)pentan-1-amine structure
|
Common Name | N,N-diethyl-5-(2,3,5-trimethylphenoxy)pentan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 5361-20-6 | Molecular Weight | 277.44500 | |
| Density | 0.919g/cm3 | Boiling Point | 384.4ºC at 760mmHg | |
| Molecular Formula | C18H31NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.2ºC | |
| Name | N,N-diethyl-5-(2,3,5-trimethylphenoxy)pentan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.919g/cm3 |
|---|---|
| Boiling Point | 384.4ºC at 760mmHg |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.44500 |
| Flash Point | 113.2ºC |
| Exact Mass | 277.24100 |
| PSA | 12.47000 |
| LogP | 4.50270 |
| Index of Refraction | 1.496 |
| InChIKey | YQAYJGCJXWJIJX-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCCCOc1cc(C)cc(C)c1C |
| HS Code | 2933990090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| CCG-7362 |
| (4,6-dimethyl-quinazolin-2-yl)-guanidine |
| (4,6-dimethyl-2-quinazolinyl) |
| 2-Guanidino-4,6-dimethyl-chinazolin |