Propanamide,N-(4,5-dichloro-2-methylphenyl)- structure
|
Common Name | Propanamide,N-(4,5-dichloro-2-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 5360-99-6 | Molecular Weight | 232.10600 | |
| Density | 1.295g/cm3 | Boiling Point | 364.1ºC at 760mmHg | |
| Molecular Formula | C10H11Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174ºC | |
| Name | N-(4,5-dichloro-2-methylphenyl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.295g/cm3 |
|---|---|
| Boiling Point | 364.1ºC at 760mmHg |
| Molecular Formula | C10H11Cl2NO |
| Molecular Weight | 232.10600 |
| Flash Point | 174ºC |
| Exact Mass | 231.02200 |
| PSA | 29.10000 |
| LogP | 3.72330 |
| Index of Refraction | 1.581 |
| InChIKey | WFDUAOFNOQPGIG-UHFFFAOYSA-N |
| SMILES | CCC(=O)Nc1cc(Cl)c(Cl)cc1C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| o-Propionyl-4.5-dichlortoluidid |