4-methoxy-N-(3-methoxyphenyl)benzenesulfonamide
Modify Date: 2025-09-19 20:22:49
4-methoxy-N-(3-methoxyphenyl)benzenesulfonamide structure
|
Common Name | 4-methoxy-N-(3-methoxyphenyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 5350-78-7 | Molecular Weight | 354.43900 | |
| Density | 1.118g/cm3 | Boiling Point | 493.2ºC at 760 mmHg | |
| Molecular Formula | C22H26O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.6ºC | |
| Name | 2-(2,2-diethyl-1-phenylbutoxy)carbonylbenzoic acid |
|---|
| Density | 1.118g/cm3 |
|---|---|
| Boiling Point | 493.2ºC at 760 mmHg |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.43900 |
| Flash Point | 166.6ºC |
| Exact Mass | 354.18300 |
| PSA | 63.60000 |
| LogP | 5.49930 |
| Index of Refraction | 1.555 |
| InChIKey | WDBURNJRJIREPN-UHFFFAOYSA-N |
| SMILES | CCC(CC)(CC)C(OC(=O)c1ccccc1C(=O)O)c1ccccc1 |
|
~%
4-methoxy-N-(3-... CAS#:5350-78-7 |
| Literature: Brodhag; Hauser Journal of the American Chemical Society, 1955 , vol. 77, p. 3024,3030 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |