3-Butyn-2-yl 4-methylbenzenesulfonate structure
|
Common Name | 3-Butyn-2-yl 4-methylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 53487-52-8 | Molecular Weight | 224.276 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 351.1±17.0 °C at 760 mmHg | |
| Molecular Formula | C11H12O3S | Melting Point | 52ºC | |
| MSDS | N/A | Flash Point | 166.2±20.9 °C | |
| Name | p-Toluenesulfonic Acid 1-Butyn-3-yl Ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 351.1±17.0 °C at 760 mmHg |
| Melting Point | 52ºC |
| Molecular Formula | C11H12O3S |
| Molecular Weight | 224.276 |
| Flash Point | 166.2±20.9 °C |
| Exact Mass | 224.050720 |
| PSA | 51.75000 |
| LogP | 2.03 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | XWRDBUBKBUYLQI-UHFFFAOYSA-N |
| SMILES | C#CC(C)OS(=O)(=O)c1ccc(C)cc1 |
| Safety Phrases | 23-24/25 |
|---|---|
| HS Code | 2905290000 |
|
~96%
3-Butyn-2-yl 4-... CAS#:53487-52-8 |
| Literature: Lowchol Scientific, Inc. Patent: US5436273 A1, 1995 ; |
|
~94%
3-Butyn-2-yl 4-... CAS#:53487-52-8 |
| Literature: UNIVERSITE DE MONTREAL Patent: EP636021 B1, 1998 ; |
|
~92%
3-Butyn-2-yl 4-... CAS#:53487-52-8 |
| Literature: Aidhen; Braslau Synthetic Communications, 1994 , vol. 24, # 6 p. 789 - 797 |
|
~88%
3-Butyn-2-yl 4-... CAS#:53487-52-8 |
| Literature: Larock, R. C.; Varaprath, S.; Lau, H. H.; Fellows, C. A. Journal of the American Chemical Society, 1984 , vol. 106, # 18 p. 5274 - 5284 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| HS Code | 2905290000 |
|---|---|
| Summary | 2905290000 unsaturated monohydric alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 3-Butyn-2-yl 4-methylbenzenesulfonate |
| 1-Methyl-2-propynyl 4-methylbenzenesulfonate |
| 1-Methyl-2-propynyl p-toluenesulfonate |
| P-TOLUENESULFONIC ACID 1-BUTYN-3-YL ESTER |
| 3-Butyn-2-ol, 4-methylbenzenesulfonate |
| But-3-yn-2-yl 4-methylbenzenesulfonate |
| 1-Butyn-3-yl p-Toluenesulfonate |