1H-Pyrrole-2,5-dione,3-hydroxy-1,4-diphenyl-
Modify Date: 2025-09-02 14:00:20
1H-Pyrrole-2,5-dione,3-hydroxy-1,4-diphenyl- structure
|
Common Name | 1H-Pyrrole-2,5-dione,3-hydroxy-1,4-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 5347-00-2 | Molecular Weight | 265.26300 | |
| Density | 1.415g/cm3 | Boiling Point | 439.9ºC at 760 mmHg | |
| Molecular Formula | C16H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.9ºC | |
| Name | 3-hydroxy-1,4-diphenylpyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.415g/cm3 |
|---|---|
| Boiling Point | 439.9ºC at 760 mmHg |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.26300 |
| Flash Point | 219.9ºC |
| Exact Mass | 265.07400 |
| PSA | 57.61000 |
| LogP | 2.59410 |
| Index of Refraction | 1.698 |
| InChIKey | KWKYBLCJMHWKJY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)N(C2=O)C3=CC=CC=C3)O |
| HS Code | 2925190090 |
|---|
|
~%
1H-Pyrrole-2,5-... CAS#:5347-00-2 |
| Literature: Metacine, Inc.; Park, Bae Keun; Yoon, Sung-Hwa; Park, Ju-Young; Park, Sung Hoon Patent: US2014/31563 A1, 2014 ; Location in patent: Paragraph 0225; 0230 ; |
|
~%
1H-Pyrrole-2,5-... CAS#:5347-00-2 |
| Literature: Metacine, Inc.; Park, Bae Keun; Yoon, Sung-Hwa; Park, Ju-Young; Park, Sung Hoon Patent: US2014/31563 A1, 2014 ; |
|
~%
1H-Pyrrole-2,5-... CAS#:5347-00-2 |
| Literature: Metacine, Inc.; Park, Bae Keun; Yoon, Sung-Hwa; Park, Ju-Young; Park, Sung Hoon Patent: US2014/31563 A1, 2014 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 5-hydroxy-1,4-diphenyl-1h-pyrrole-2,3-dione |
| 5-hydroxy-1,4-diphenylpyrrole-2,3-dione |
| 3-hydroxy-1,4-diphenyl-1H-pyrrole-2,5-dione |