3-Heptanone,4-(2,2-dimethylpropyl)-6,6-dimethyl- structure
|
Common Name | 3-Heptanone,4-(2,2-dimethylpropyl)-6,6-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 5340-60-3 | Molecular Weight | 212.37200 | |
| Density | 0.825g/cm3 | Boiling Point | 239.4ºC at 760mmHg | |
| Molecular Formula | C14H28O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 65ºC | |
| Name | 4-(2,2-dimethylpropyl)-6,6-dimethylheptan-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.825g/cm3 |
|---|---|
| Boiling Point | 239.4ºC at 760mmHg |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.37200 |
| Flash Point | 65ºC |
| Exact Mass | 212.21400 |
| PSA | 17.07000 |
| LogP | 4.45410 |
| Index of Refraction | 1.432 |
| InChIKey | NEXQWQPIOPKSGW-UHFFFAOYSA-N |
| SMILES | CCC(=O)C(CC(C)(C)C)CC(C)(C)C |
| HS Code | 2914190090 |
|---|
|
~%
3-Heptanone,4-(... CAS#:5340-60-3 |
| Literature: Whitmore; Lester Journal of the American Chemical Society, 1942 , vol. 64, p. 1247,1250 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914190090 |
|---|---|
| Summary | 2914190090 other acyclic ketones without other oxygen function。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 6,6-dimethyl-4-neopentyl-heptan-3-one |
| 6,6-DIMETHYL-4-NEOPENTYL-3-HEPTANONE |