2,2,2-TRICHLORO-1-(4-NITRO-1H-PYRROL-2-YL)-ETHANONE structure
|
Common Name | 2,2,2-TRICHLORO-1-(4-NITRO-1H-PYRROL-2-YL)-ETHANONE | ||
|---|---|---|---|---|
| CAS Number | 53391-50-7 | Molecular Weight | 257.45900 | |
| Density | 1.771g/cm3 | Boiling Point | 333.3ºC at 760mmHg | |
| Molecular Formula | C6H3Cl3N2O3 | Melting Point | 178-179ºC | |
| MSDS | N/A | Flash Point | 155.4ºC | |
| Name | 2,2,2-trichloro-1-(4-nitro-1H-pyrrol-2-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.771g/cm3 |
|---|---|
| Boiling Point | 333.3ºC at 760mmHg |
| Melting Point | 178-179ºC |
| Molecular Formula | C6H3Cl3N2O3 |
| Molecular Weight | 257.45900 |
| Flash Point | 155.4ºC |
| Exact Mass | 255.92100 |
| PSA | 78.68000 |
| LogP | 2.99900 |
| Index of Refraction | 1.63 |
| InChIKey | XFHRTOGIBMVNEV-UHFFFAOYSA-N |
| SMILES | O=C(c1cc([N+](=O)[O-])c[nH]1)C(Cl)(Cl)Cl |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~67%
2,2,2-TRICHLORO... CAS#:53391-50-7 |
| Literature: Organic and Biomolecular Chemistry, , vol. 1, # 19 p. 3327 - 3342 |
|
~0%
2,2,2-TRICHLORO... CAS#:53391-50-7 |
| Literature: Tetrahedron Letters, , vol. 46, # 42 p. 7101 - 7105 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| trichloronitropyrrolylethanone |
| 2,2':6',2''-TERPYRIDINE-1,1'-DIOXIDE |