5,6-dimethyl-N-[(3-nitrophenyl)methylideneamino]-2-phenyl-pyrimidin-4-amine structure
|
Common Name | 5,6-dimethyl-N-[(3-nitrophenyl)methylideneamino]-2-phenyl-pyrimidin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 5338-94-3 | Molecular Weight | 165.23200 | |
| Density | 1.042g/cm3 | Boiling Point | 283.2ºC at 760 mmHg | |
| Molecular Formula | C10H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.3ºC | |
| Name | 1-[4-(dimethylamino)phenyl]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.042g/cm3 |
|---|---|
| Boiling Point | 283.2ºC at 760 mmHg |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.23200 |
| Flash Point | 135.3ºC |
| Exact Mass | 165.11500 |
| PSA | 23.47000 |
| LogP | 1.80590 |
| Index of Refraction | 1.565 |
| HS Code | 2922199090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 3 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-<(Dimethylamino)phenyl>ethanol |
| 1-Propanone,1-[4-(dimethylamino)phenyl]-2-methyl |
| 1-(4-(dimethylamino)phenyl)-2-methylpropan-1-one |
| (N,N-dimethylamino-4)phenyl-1 ethanol |
| <p-Dimethylamino-phenyl>-isopropyl-keton |
| p-(CH3)2NC6H4C(O)CH(CH3)2 |
| p-N,N-Dimethylaminoisobutyrophenon |
| 1-(4-(dimethylamino)phenyl)ethyl alcohol |
| 1-<4-(N,N-dimethylamino)phenyl>-2-methylpropan-1-one |
| 1-[4-(N,N-dimethylamino)phenyl]ethanol |
| (4-Dimethylaminophenyl)-isopropylketon |