11-methyl-7-oxododec-10-enoic acid structure
|
Common Name | 11-methyl-7-oxododec-10-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 53377-63-2 | Molecular Weight | 226.31200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 11-methyl-7-oxododec-10-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H22O3 |
|---|---|
| Molecular Weight | 226.31200 |
| Exact Mass | 226.15700 |
| PSA | 54.37000 |
| LogP | 3.33700 |
| InChIKey | YOVXUUXZGWUVQA-UHFFFAOYSA-N |
| SMILES | CC(C)=CCCC(=O)CCCCCC(=O)O |
|
~%
11-methyl-7-oxo... CAS#:53377-63-2 |
| Literature: Brown,E.; Dhal,R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 2190 - 2193 |
|
~%
11-methyl-7-oxo... CAS#:53377-63-2 |
| Literature: Brown,E.; Dhal,R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 2190 - 2193 |
|
~%
11-methyl-7-oxo... CAS#:53377-63-2 |
| Literature: Brown,E.; Dhal,R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 2190 - 2193 |
| 10-Dodecenoic acid,11-methyl-7-oxo |
| 7-Oxo-11-methyldodec-10-ensaeure |