diethyl 2-(5-methylhex-4-enoyl)heptanedioate structure
|
Common Name | diethyl 2-(5-methylhex-4-enoyl)heptanedioate | ||
|---|---|---|---|---|
| CAS Number | 53377-62-1 | Molecular Weight | 326.42800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H30O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-(5-methylhex-4-enoyl)heptanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H30O5 |
|---|---|
| Molecular Weight | 326.42800 |
| Exact Mass | 326.20900 |
| PSA | 69.67000 |
| LogP | 3.60470 |
| InChIKey | JQYQUHFTBAAPLD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCC(C(=O)CCC=C(C)C)C(=O)OCC |
|
~%
diethyl 2-(5-me... CAS#:53377-62-1 |
| Literature: Brown,E.; Dhal,R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 2190 - 2193 |
|
~%
diethyl 2-(5-me... CAS#:53377-62-1 |
| Literature: Brown,E.; Dhal,R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 2190 - 2193 |
| Heptanedioic acid,2-(5-methyl-1-oxo-4-hexenyl)-,diethyl ester |