siderin
Modify Date: 2025-08-25 17:40:48
siderin structure
|
Common Name | siderin | ||
|---|---|---|---|---|
| CAS Number | 53377-54-1 | Molecular Weight | 220.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of siderinSiderin is a Photosystem II inhibitor that effectively inhibits ATP synthesis and chloroplast electron transport during photosynthesis in isolated spinach. Siderin can be used in the study of plant photosynthesis[1]. |
| Name | siderin |
|---|---|
| Synonym | More Synonyms |
| Description | Siderin is a Photosystem II inhibitor that effectively inhibits ATP synthesis and chloroplast electron transport during photosynthesis in isolated spinach. Siderin can be used in the study of plant photosynthesis[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C12H12O4 |
|---|---|
| Molecular Weight | 220.22 |
| Exact Mass | 220.07400 |
| PSA | 48.67000 |
| LogP | 2.11860 |
| InChIKey | LLTOPKQGFAAMKH-UHFFFAOYSA-N |
| SMILES | COc1cc(C)c2c(OC)cc(=O)oc2c1 |
| 4,7-dimethoxy-5-methyl-chromen-2-one |
| 4,7-dimethoxy-5-methylcoumarin |
| 4,7-dimethoxy-5-methyl-2H-chromen-2-one |
| 4,7-Dimethoxy-5-methyl-coumarin |
| 4,6-Dimethoxy-5-methyl-coumarin |
| 4,7-Dimethoxy-5-methyl-chromen-2-one |
| 5-methyl-4,7-dimethoxy-coumarin |