methyl 1-benzyl-4,5-dioxo-pyrrolidine-3-carboxylate
Modify Date: 2025-09-16 12:06:54
methyl 1-benzyl-4,5-dioxo-pyrrolidine-3-carboxylate structure
|
Common Name | methyl 1-benzyl-4,5-dioxo-pyrrolidine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5336-41-4 | Molecular Weight | 247.24700 | |
| Density | 1.31g/cm3 | Boiling Point | 382.4ºC at 760 mmHg | |
| Molecular Formula | C13H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.1ºC | |
| Name | methyl 1-benzyl-4,5-dioxopyrrolidine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 382.4ºC at 760 mmHg |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.24700 |
| Flash Point | 185.1ºC |
| Exact Mass | 247.08400 |
| PSA | 63.68000 |
| LogP | 0.32500 |
| Index of Refraction | 1.575 |
| InChIKey | PMZXKPNJLDBYCF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CN(Cc2ccccc2)C(=O)C1=O |
| HS Code | 2933990090 |
|---|
|
~%
methyl 1-benzyl... CAS#:5336-41-4 |
| Literature: Southwick; Crouch Journal of the American Chemical Society, 1953 , vol. 75, p. 3413,3416 |
|
~%
methyl 1-benzyl... CAS#:5336-41-4 |
| Literature: Southwick; Crouch Journal of the American Chemical Society, 1953 , vol. 75, p. 3413,3416 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Benzyl-4,5-dioxo-pyrrolidin-3-carbonsaeure-methylester |
| 1-benzyl-4-methoxycarbonyl-2,3-dioxopyrrolidine |
| HMS3079E07 |
| 1-benzyl-4,5-dioxo-pyrrolidine-3-carboxylic acid methyl ester |