2-[[5-[(4-methoxyphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methylsulfanylphenyl)acetamide structure
|
Common Name | 2-[[5-[(4-methoxyphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methylsulfanylphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 5330-87-0 | Molecular Weight | 538.50800 | |
| Density | 1.25g/cm3 | Boiling Point | 900.4ºC at 760mmHg | |
| Molecular Formula | C20H18N4O10S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 498.3ºC | |
| Name | n,n'-bis(4-nitrobenzoyl)cystine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 900.4ºC at 760mmHg |
| Molecular Formula | C20H18N4O10S2 |
| Molecular Weight | 538.50800 |
| Flash Point | 498.3ºC |
| Exact Mass | 538.04600 |
| PSA | 275.04000 |
| LogP | 3.77880 |
| Index of Refraction | 1.624 |
| InChIKey | UVYFOLWELOVJQB-UHFFFAOYSA-N |
| SMILES | O=C(NC(CSSCC(NC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)O)C(=O)O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2930909090 |
|---|
|
~13%
2-[[5-[(4-metho... CAS#:5330-87-0 |
| Literature: Menger; Caran Journal of the American Chemical Society, 2000 , vol. 122, # 47 p. 11679 - 11691 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| bis(p-tolylimidoyl)chloride |
| N,N'-bis-(4-nitro-benzoyl)-L-cystine |
| N,N'-bis(4-methylphenyl)ethane-bis(imidoyl) dichloride |
| oxalic acid bisimidoylchloride |
| N,N'-di(p-nitrobenzoyl)-L-cystine |
| di-p-tolyl-oxalodiimidoyl dichloride |
| N,N'-Bis-(4-nitro-benzoyl)-L-cystin |
| oxalic acid bis(4-methylphenylimidoyl)chloride |
| N,N'-bis(4-tolyl)ethanebis(imidoyl) dichloride |