2,4-Quinolinedicarboxylicacid structure
|
Common Name | 2,4-Quinolinedicarboxylicacid | ||
|---|---|---|---|---|
| CAS Number | 5323-57-9 | Molecular Weight | 217.17800 | |
| Density | 1.531g/cm3 | Boiling Point | 451.4ºC at 760mmHg | |
| Molecular Formula | C11H7NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.8ºC | |
| Name | quinoline-2,4-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.531g/cm3 |
|---|---|
| Boiling Point | 451.4ºC at 760mmHg |
| Molecular Formula | C11H7NO4 |
| Molecular Weight | 217.17800 |
| Flash Point | 226.8ºC |
| Exact Mass | 217.03800 |
| PSA | 87.49000 |
| LogP | 1.63120 |
| Index of Refraction | 1.72 |
| InChIKey | JPGZDTDZZDLVHW-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(C(=O)O)c2ccccc2n1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933499090 |
| Precursor 8 | |
|---|---|
| DownStream 6 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-Quinolinedicarboxylic acid |
| 2,4-dicarboxyquinoline |
| Chinolin-2,4-dicarbonsaeure |