Morellic acid
Modify Date: 2025-08-25 19:21:39
Morellic acid structure
|
Common Name | Morellic acid | ||
|---|---|---|---|---|
| CAS Number | 5304-71-2 | Molecular Weight | 453.57500 | |
| Density | 1.36±0.1 g/cm3(Predicted) | Boiling Point | 777.6±60.0 °C(Predicted) | |
| Molecular Formula | C33H36O8 | Melting Point | 94 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of Morellic acidMorellic acid is isolated from Garcinia Morella with an antiangiogenic activity[1]. |
| Name | 1'-benzyl-2-(4-methoxyphenyl)-9-methylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-piperidine] |
|---|---|
| Synonym | More Synonyms |
| Description | Morellic acid is isolated from Garcinia Morella with an antiangiogenic activity[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: antiangiogenic[1] |
| In Vitro | Morellic acid inhibits the migration of HUVEC at a low concentration of 0.5 µM in HUVEC cell migration assay in vitro[1]. |
| References |
| Density | 1.36±0.1 g/cm3(Predicted) |
|---|---|
| Boiling Point | 777.6±60.0 °C(Predicted) |
| Melting Point | 94 °C |
| Molecular Formula | C33H36O8 |
| Molecular Weight | 453.57500 |
| Exact Mass | 453.24200 |
| PSA | 37.30000 |
| LogP | 4.85080 |
| InChIKey | COVMVPHACFXMAX-NZARMYSCSA-N |
| SMILES | CC(C)=CCc1c2c(c(O)c3c1OC14C(=CC5CC1C(C)(C)OC4(CC=C(C)C(=O)O)C5=O)C3=O)C=CC(C)(C)O2 |
| 1-benzyl-2'-(4-methoxyphenyl)-9'-methyl-1',10b'-dihydrospiro[piperidine-4,5'-pyrazolo[1,5-c][1,3]benzoxazine] |