(2,2-Dichlorovinyl)isopropylmethyl=phosphate
Modify Date: 2025-08-25 12:31:25
(2,2-Dichlorovinyl)isopropylmethyl=phosphate structure
|
Common Name | (2,2-Dichlorovinyl)isopropylmethyl=phosphate | ||
|---|---|---|---|---|
| CAS Number | 5301-54-2 | Molecular Weight | 249.02900 | |
| Density | 1.329g/cm3 | Boiling Point | 214ºC at 760 mmHg | |
| Molecular Formula | C6H11Cl2O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 62.9ºC | |
| Name | 2,2-dichloroethenyl methyl propan-2-yl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.329g/cm3 |
|---|---|
| Boiling Point | 214ºC at 760 mmHg |
| Molecular Formula | C6H11Cl2O4P |
| Molecular Weight | 249.02900 |
| Flash Point | 62.9ºC |
| Exact Mass | 247.97700 |
| PSA | 54.57000 |
| LogP | 3.45900 |
| Index of Refraction | 1.462 |
| InChIKey | VBAXPQCCVNMHRC-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC=C(Cl)Cl)OC(C)C |
| HS Code | 2919900090 |
|---|
|
~%
(2,2-Dichlorovi... CAS#:5301-54-2 |
| Literature: Morales,J.G. et al. Journal of Medicinal Chemistry, 1972 , vol. 15, p. 1225 - 1231 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Phosphoric acid,2,2-dichlorovinyl isopropyl methyl ester |
| O-Isopropyl-O-methyl-O-dichlorvinyl-phosphat |
| 2,2-Dichlorovinyl isopropyl methyl ester of phosphoric acid |
| phosphoric acid 2,2-dichloro-vinyl ester isopropyl ester methyl ester |