(2,2-Dichlorovinyl)heptylmethyl=phosphate
Modify Date: 2025-10-17 20:53:33
(2,2-Dichlorovinyl)heptylmethyl=phosphate structure
|
Common Name | (2,2-Dichlorovinyl)heptylmethyl=phosphate | ||
|---|---|---|---|---|
| CAS Number | 23248-43-3 | Molecular Weight | 305.13500 | |
| Density | 1.205g/cm3 | Boiling Point | 294.5ºC at 760 mmHg | |
| Molecular Formula | C10H19Cl2O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167ºC | |
| Name | 2,2-dichloroethenyl heptyl methyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 294.5ºC at 760 mmHg |
| Molecular Formula | C10H19Cl2O4P |
| Molecular Weight | 305.13500 |
| Flash Point | 167ºC |
| Exact Mass | 304.04000 |
| PSA | 54.57000 |
| LogP | 5.02100 |
| Vapour Pressure | 0.00283mmHg at 25°C |
| Index of Refraction | 1.466 |
| InChIKey | QANJVSVOBYIYAA-UHFFFAOYSA-N |
| SMILES | CCCCCCCOP(=O)(OC)OC=C(Cl)Cl |
| HS Code | 2919900090 |
|---|
|
~%
(2,2-Dichlorovi... CAS#:23248-43-3 |
| Literature: Morales,J.G. et al. Journal of Medicinal Chemistry, 1972 , vol. 15, p. 1225 - 1231 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| phosphoric acid 2,2-dichloro-vinyl ester heptyl ester methyl ester |
| 2,2-Dichlorovinyl heptyl methyl ester of phosphoric acid |
| Phosphoric acid,2,2-dichlorovinyl heptyl methyl ester |